About 3-methylbutan-1-amine;hydrochloride
3-methylbutan-1-amine;hydrochloride (PubChem CID 10922) has the molecular formula C5H14ClN
and a molecular weight of 123.63 g/mol. Its IUPAC name is 3-methylbutan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 3-methylbutan-1-amine;hydrochloride |
| PubChem CID | 10922 |
| Molecular Formula | C5H14ClN |
| Molecular Weight | 123.63 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | 3-methylbutan-1-amine;hydrochloride |
| SMILES | CC(C)CCN.Cl |
| InChI | InChI=1S/C5H13N.ClH/c1-5(2)3-4-6;/h5H,3-4,6H2,1-2H3;1H |
| InChIKey | HOMVDRDAAUYWKL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.63 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methylbutan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutan-1-amine;hydrochloride?
The IUPAC name of 3-methylbutan-1-amine;hydrochloride (CID 10922) is 3-methylbutan-1-amine;hydrochloride.
What is the SMILES notation for 3-methylbutan-1-amine;hydrochloride?
The canonical SMILES for 3-methylbutan-1-amine;hydrochloride is CC(C)CCN.Cl.
What is the InChIKey of 3-methylbutan-1-amine;hydrochloride?
The InChIKey is HOMVDRDAAUYWKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N.ClH/c1-5(2)3-4-6;/h5H,3-4,6H2,1-2H3;1H.
What are the key properties of 3-methylbutan-1-amine;hydrochloride?
3-methylbutan-1-amine;hydrochloride has a molecular weight of 123.63 g/mol, XLogP of 1.41, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutan-1-amine;hydrochloride is sourced from PubChem (CID 10922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).