C20H17F2N3O — CID 109220308
4-(3,4-difluoroanilino)-N-ethyl-N-phenylpyridine-2-carboxamide (PubChem CID 109220308) has the molecular formula C20H17F2N3O and a molecular weight of 353.37 g/mol. Its IUPAC name is 4-(3,4-difluoroanilino)-N-ethyl-N-phenylpyridine-2-carboxamide.
| Compound Name | 4-(3,4-difluoroanilino)-N-ethyl-N-phenylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 109220308 |
| Molecular Formula | C20H17F2N3O |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 4-(3,4-difluoroanilino)-N-ethyl-N-phenylpyridine-2-carboxamide |
| SMILES | CCN(C(=O)c1cc(Nc2ccc(F)c(F)c2)ccn1)c1ccccc1 |
| InChI | InChI=1S/C20H17F2N3O/c1-2-25(16-6-4-3-5-7-16)20(26)19-13-15(10-11-23-19)24-14-8-9-17(21)18(22)12-14/h3-13H,2H2,1H3,(H,23,24) |
| InChIKey | MUCDMBVFADPORY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |