C18H12F3N3O — CID 109220720
N-(2,6-difluorophenyl)-4-(2-fluoroanilino)pyridine-2-carboxamide (PubChem CID 109220720) has the molecular formula C18H12F3N3O and a molecular weight of 343.31 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-4-(2-fluoroanilino)pyridine-2-carboxamide.
| Compound Name | N-(2,6-difluorophenyl)-4-(2-fluoroanilino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109220720 |
| Molecular Formula | C18H12F3N3O |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | N-(2,6-difluorophenyl)-4-(2-fluoroanilino)pyridine-2-carboxamide |
| SMILES | O=C(Nc1c(F)cccc1F)c1cc(Nc2ccccc2F)ccn1 |
| InChI | InChI=1S/C18H12F3N3O/c19-12-4-1-2-7-15(12)23-11-8-9-22-16(10-11)18(25)24-17-13(20)5-3-6-14(17)21/h1-10H,(H,22,23)(H,24,25) |
| InChIKey | QKISLVIJAWFGSC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |