C18H12Cl2FN3O — CID 109220837
N-(3,4-dichlorophenyl)-4-(4-fluoroanilino)pyridine-2-carboxamide (PubChem CID 109220837) has the molecular formula C18H12Cl2FN3O and a molecular weight of 376.22 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-4-(4-fluoroanilino)pyridine-2-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-4-(4-fluoroanilino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109220837 |
| Molecular Formula | C18H12Cl2FN3O |
| Molecular Weight | 376.22 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | N-(3,4-dichlorophenyl)-4-(4-fluoroanilino)pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)c1cc(Nc2ccc(F)cc2)ccn1 |
| InChI | InChI=1S/C18H12Cl2FN3O/c19-15-6-5-13(9-16(15)20)24-18(25)17-10-14(7-8-22-17)23-12-3-1-11(21)2-4-12/h1-10H,(H,22,23)(H,24,25) |
| InChIKey | QSRNJAVKAJGVMQ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.22 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |