About thieno[2,3-f][1,3]benzodioxole-6-carboxylic acid
thieno[2,3-f][1,3]benzodioxole-6-carboxylic acid (PubChem CID 10922084) has the molecular formula C10H6O4S
and a molecular weight of 222.22 g/mol. Its IUPAC name is thieno[2,3-f][1,3]benzodioxole-6-carboxylic acid.
Molecular Properties
| Compound Name | thieno[2,3-f][1,3]benzodioxole-6-carboxylic acid |
| PubChem CID | 10922084 |
| Molecular Formula | C10H6O4S |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | thieno[2,3-f][1,3]benzodioxole-6-carboxylic acid |
| SMILES | O=C(O)c1cc2cc3c(cc2s1)OCO3 |
| InChI | InChI=1S/C10H6O4S/c11-10(12)9-2-5-1-6-7(14-4-13-6)3-8(5)15-9/h1-3H,4H2,(H,11,12) |
| InChIKey | DDYQAKGAKIASSJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze thieno[2,3-f][1,3]benzodioxole-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[2,3-f][1,3]benzodioxole-6-carboxylic acid?
The IUPAC name of thieno[2,3-f][1,3]benzodioxole-6-carboxylic acid (CID 10922084) is thieno[2,3-f][1,3]benzodioxole-6-carboxylic acid.
What is the SMILES notation for thieno[2,3-f][1,3]benzodioxole-6-carboxylic acid?
The canonical SMILES for thieno[2,3-f][1,3]benzodioxole-6-carboxylic acid is O=C(O)c1cc2cc3c(cc2s1)OCO3.
What is the InChIKey of thieno[2,3-f][1,3]benzodioxole-6-carboxylic acid?
The InChIKey is DDYQAKGAKIASSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6O4S/c11-10(12)9-2-5-1-6-7(14-4-13-6)3-8(5)15-9/h1-3H,4H2,(H,11,12).
What are the key properties of thieno[2,3-f][1,3]benzodioxole-6-carboxylic acid?
thieno[2,3-f][1,3]benzodioxole-6-carboxylic acid has a molecular weight of 222.22 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[2,3-f][1,3]benzodioxole-6-carboxylic acid is sourced from PubChem (CID 10922084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).