About 2,2-difluoro-N,N-bis(2-methoxyethyl)propanamide
2,2-difluoro-N,N-bis(2-methoxyethyl)propanamide (PubChem CID 10922182) has the molecular formula C9H17F2NO3
and a molecular weight of 225.23 g/mol. Its IUPAC name is 2,2-difluoro-N,N-bis(2-methoxyethyl)propanamide.
Molecular Properties
| Compound Name | 2,2-difluoro-N,N-bis(2-methoxyethyl)propanamide |
| PubChem CID | 10922182 |
| Molecular Formula | C9H17F2NO3 |
| Molecular Weight | 225.23 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2,2-difluoro-N,N-bis(2-methoxyethyl)propanamide |
| SMILES | COCCN(CCOC)C(=O)C(C)(F)F |
| InChI | InChI=1S/C9H17F2NO3/c1-9(10,11)8(13)12(4-6-14-2)5-7-15-3/h4-7H2,1-3H3 |
| InChIKey | VHCMZTOOHLKEMX-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-difluoro-N,N-bis(2-methoxyethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-N,N-bis(2-methoxyethyl)propanamide?
The IUPAC name of 2,2-difluoro-N,N-bis(2-methoxyethyl)propanamide (CID 10922182) is 2,2-difluoro-N,N-bis(2-methoxyethyl)propanamide.
What is the SMILES notation for 2,2-difluoro-N,N-bis(2-methoxyethyl)propanamide?
The canonical SMILES for 2,2-difluoro-N,N-bis(2-methoxyethyl)propanamide is COCCN(CCOC)C(=O)C(C)(F)F.
What is the InChIKey of 2,2-difluoro-N,N-bis(2-methoxyethyl)propanamide?
The InChIKey is VHCMZTOOHLKEMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F2NO3/c1-9(10,11)8(13)12(4-6-14-2)5-7-15-3/h4-7H2,1-3H3.
What are the key properties of 2,2-difluoro-N,N-bis(2-methoxyethyl)propanamide?
2,2-difluoro-N,N-bis(2-methoxyethyl)propanamide has a molecular weight of 225.23 g/mol, XLogP of 0.76, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-N,N-bis(2-methoxyethyl)propanamide is sourced from PubChem (CID 10922182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).