C20H17F2N3O3 — CID 109221968
4-(2,4-difluoroanilino)-N-(2,5-dimethoxyphenyl)pyridine-2-carboxamide (PubChem CID 109221968) has the molecular formula C20H17F2N3O3 and a molecular weight of 385.37 g/mol. Its IUPAC name is 4-(2,4-difluoroanilino)-N-(2,5-dimethoxyphenyl)pyridine-2-carboxamide.
| Compound Name | 4-(2,4-difluoroanilino)-N-(2,5-dimethoxyphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109221968 |
| Molecular Formula | C20H17F2N3O3 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 4-(2,4-difluoroanilino)-N-(2,5-dimethoxyphenyl)pyridine-2-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2cc(Nc3ccc(F)cc3F)ccn2)c1 |
| InChI | InChI=1S/C20H17F2N3O3/c1-27-14-4-6-19(28-2)17(11-14)25-20(26)18-10-13(7-8-23-18)24-16-5-3-12(21)9-15(16)22/h3-11H,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | UHMDDZIXVAONNC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |