About 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-2-methylpropan-1-ol
2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-2-methylpropan-1-ol (PubChem CID 10922198) has the molecular formula C10H12ClN3O
and a molecular weight of 225.68 g/mol. Its IUPAC name is 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-2-methylpropan-1-ol.
Molecular Properties
| Compound Name | 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-2-methylpropan-1-ol |
| PubChem CID | 10922198 |
| Molecular Formula | C10H12ClN3O |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-2-methylpropan-1-ol |
| SMILES | CC(C)(CO)c1cn2nc(Cl)ccc2n1 |
| InChI | InChI=1S/C10H12ClN3O/c1-10(2,6-15)7-5-14-9(12-7)4-3-8(11)13-14/h3-5,15H,6H2,1-2H3 |
| InChIKey | AJILDJMHQKNBDW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-2-methylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-2-methylpropan-1-ol?
The IUPAC name of 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-2-methylpropan-1-ol (CID 10922198) is 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-2-methylpropan-1-ol.
What is the SMILES notation for 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-2-methylpropan-1-ol?
The canonical SMILES for 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-2-methylpropan-1-ol is CC(C)(CO)c1cn2nc(Cl)ccc2n1.
What is the InChIKey of 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-2-methylpropan-1-ol?
The InChIKey is AJILDJMHQKNBDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClN3O/c1-10(2,6-15)7-5-14-9(12-7)4-3-8(11)13-14/h3-5,15H,6H2,1-2H3.
What are the key properties of 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-2-methylpropan-1-ol?
2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-2-methylpropan-1-ol has a molecular weight of 225.68 g/mol, XLogP of 1.65, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)-2-methylpropan-1-ol is sourced from PubChem (CID 10922198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).