C22H19N3O4 — CID 109222174
methyl 3-[[4-(4-acetylanilino)pyridine-2-carbonyl]amino]benzoate (PubChem CID 109222174) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is methyl 3-[[4-(4-acetylanilino)pyridine-2-carbonyl]amino]benzoate.
| Compound Name | methyl 3-[[4-(4-acetylanilino)pyridine-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109222174 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | methyl 3-[[4-(4-acetylanilino)pyridine-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2cc(Nc3ccc(C(C)=O)cc3)ccn2)c1 |
| InChI | InChI=1S/C22H19N3O4/c1-14(26)15-6-8-17(9-7-15)24-19-10-11-23-20(13-19)21(27)25-18-5-3-4-16(12-18)22(28)29-2/h3-13H,1-2H3,(H,23,24)(H,25,27) |
| InChIKey | ISMXHGRUBZOJAO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |