About benzyl 2-chloro-3-oxobutanoate
benzyl 2-chloro-3-oxobutanoate (PubChem CID 10922235) has the molecular formula C11H11ClO3
and a molecular weight of 226.66 g/mol. Its IUPAC name is benzyl 2-chloro-3-oxobutanoate.
Molecular Properties
| Compound Name | benzyl 2-chloro-3-oxobutanoate |
| PubChem CID | 10922235 |
| Molecular Formula | C11H11ClO3 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | benzyl 2-chloro-3-oxobutanoate |
| SMILES | CC(=O)C(Cl)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C11H11ClO3/c1-8(13)10(12)11(14)15-7-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3 |
| InChIKey | PVVLYVXLOBBQBK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-chloro-3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-chloro-3-oxobutanoate?
The IUPAC name of benzyl 2-chloro-3-oxobutanoate (CID 10922235) is benzyl 2-chloro-3-oxobutanoate.
What is the SMILES notation for benzyl 2-chloro-3-oxobutanoate?
The canonical SMILES for benzyl 2-chloro-3-oxobutanoate is CC(=O)C(Cl)C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 2-chloro-3-oxobutanoate?
The InChIKey is PVVLYVXLOBBQBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClO3/c1-8(13)10(12)11(14)15-7-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3.
What are the key properties of benzyl 2-chloro-3-oxobutanoate?
benzyl 2-chloro-3-oxobutanoate has a molecular weight of 226.66 g/mol, XLogP of 1.93, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-chloro-3-oxobutanoate is sourced from PubChem (CID 10922235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).