C12H20S2 — CID 10922282
2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1,3-dithiolane (PubChem CID 10922282) has the molecular formula C12H20S2 and a molecular weight of 228.43 g/mol. Its IUPAC name is 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1,3-dithiolane.
| Compound Name | 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1,3-dithiolane |
|---|---|
| PubChem CID | 10922282 |
| Molecular Formula | C12H20S2 |
| Molecular Weight | 228.43 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-1,3-dithiolane |
| SMILES | CC(C)=CCC/C(C)=C/C1SCCS1 |
| InChI | InChI=1S/C12H20S2/c1-10(2)5-4-6-11(3)9-12-13-7-8-14-12/h5,9,12H,4,6-8H2,1-3H3/b11-9+ |
| InChIKey | SADYVTLTQBADKW-PKNBQFBNSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|