About 1-(4-hydroxy-3,4-dihydro-2H-pyridin-1-yl)-3-phenylpropan-1-one
1-(4-hydroxy-3,4-dihydro-2H-pyridin-1-yl)-3-phenylpropan-1-one (PubChem CID 10922366) has the molecular formula C14H17NO2
and a molecular weight of 231.30 g/mol. Its IUPAC name is 1-(4-hydroxy-3,4-dihydro-2H-pyridin-1-yl)-3-phenylpropan-1-one.
Molecular Properties
| Compound Name | 1-(4-hydroxy-3,4-dihydro-2H-pyridin-1-yl)-3-phenylpropan-1-one |
| PubChem CID | 10922366 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 1-(4-hydroxy-3,4-dihydro-2H-pyridin-1-yl)-3-phenylpropan-1-one |
| SMILES | O=C(CCc1ccccc1)N1C=CC(O)CC1 |
| InChI | InChI=1S/C14H17NO2/c16-13-8-10-15(11-9-13)14(17)7-6-12-4-2-1-3-5-12/h1-5,8,10,13,16H,6-7,9,11H2 |
| InChIKey | IGRJBTVEXGGCBK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-hydroxy-3,4-dihydro-2H-pyridin-1-yl)-3-phenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-hydroxy-3,4-dihydro-2H-pyridin-1-yl)-3-phenylpropan-1-one?
The IUPAC name of 1-(4-hydroxy-3,4-dihydro-2H-pyridin-1-yl)-3-phenylpropan-1-one (CID 10922366) is 1-(4-hydroxy-3,4-dihydro-2H-pyridin-1-yl)-3-phenylpropan-1-one.
What is the SMILES notation for 1-(4-hydroxy-3,4-dihydro-2H-pyridin-1-yl)-3-phenylpropan-1-one?
The canonical SMILES for 1-(4-hydroxy-3,4-dihydro-2H-pyridin-1-yl)-3-phenylpropan-1-one is O=C(CCc1ccccc1)N1C=CC(O)CC1.
What is the InChIKey of 1-(4-hydroxy-3,4-dihydro-2H-pyridin-1-yl)-3-phenylpropan-1-one?
The InChIKey is IGRJBTVEXGGCBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO2/c16-13-8-10-15(11-9-13)14(17)7-6-12-4-2-1-3-5-12/h1-5,8,10,13,16H,6-7,9,11H2.
What are the key properties of 1-(4-hydroxy-3,4-dihydro-2H-pyridin-1-yl)-3-phenylpropan-1-one?
1-(4-hydroxy-3,4-dihydro-2H-pyridin-1-yl)-3-phenylpropan-1-one has a molecular weight of 231.30 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-hydroxy-3,4-dihydro-2H-pyridin-1-yl)-3-phenylpropan-1-one is sourced from PubChem (CID 10922366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).