C16H17Cl2N3O — CID 109225291
N-butan-2-yl-5-(3,5-dichloroanilino)pyridine-3-carboxamide (PubChem CID 109225291) has the molecular formula C16H17Cl2N3O and a molecular weight of 338.24 g/mol. Its IUPAC name is N-butan-2-yl-5-(3,5-dichloroanilino)pyridine-3-carboxamide.
| Compound Name | N-butan-2-yl-5-(3,5-dichloroanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109225291 |
| Molecular Formula | C16H17Cl2N3O |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | N-butan-2-yl-5-(3,5-dichloroanilino)pyridine-3-carboxamide |
| SMILES | CCC(C)NC(=O)c1cncc(Nc2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C16H17Cl2N3O/c1-3-10(2)20-16(22)11-4-15(9-19-8-11)21-14-6-12(17)5-13(18)7-14/h4-10,21H,3H2,1-2H3,(H,20,22) |
| InChIKey | MMJRCEKLABMULX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |