About 2-phenylsulfanyloctanal
2-phenylsulfanyloctanal (PubChem CID 10922545) has the molecular formula C14H20OS
and a molecular weight of 236.38 g/mol. Its IUPAC name is 2-phenylsulfanyloctanal.
Molecular Properties
| Compound Name | 2-phenylsulfanyloctanal |
| PubChem CID | 10922545 |
| Molecular Formula | C14H20OS |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2-phenylsulfanyloctanal |
| SMILES | CCCCCCC(C=O)Sc1ccccc1 |
| InChI | InChI=1S/C14H20OS/c1-2-3-4-6-11-14(12-15)16-13-9-7-5-8-10-13/h5,7-10,12,14H,2-4,6,11H2,1H3 |
| InChIKey | HZDYXYWDUJXKRE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylsulfanyloctanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylsulfanyloctanal?
The IUPAC name of 2-phenylsulfanyloctanal (CID 10922545) is 2-phenylsulfanyloctanal.
What is the SMILES notation for 2-phenylsulfanyloctanal?
The canonical SMILES for 2-phenylsulfanyloctanal is CCCCCCC(C=O)Sc1ccccc1.
What is the InChIKey of 2-phenylsulfanyloctanal?
The InChIKey is HZDYXYWDUJXKRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20OS/c1-2-3-4-6-11-14(12-15)16-13-9-7-5-8-10-13/h5,7-10,12,14H,2-4,6,11H2,1H3.
What are the key properties of 2-phenylsulfanyloctanal?
2-phenylsulfanyloctanal has a molecular weight of 236.38 g/mol, XLogP of 4.32, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylsulfanyloctanal is sourced from PubChem (CID 10922545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).