C12H15NO2S — CID 10922568
3-[(1R,2R,3S,4S)-3-methylbicyclo[2.2.1]hept-5-ene-2-carbonyl]-1,3-thiazolidin-2-one (PubChem CID 10922568) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 3-[(1R,2R,3S,4S)-3-methylbicyclo[2.2.1]hept-5-ene-2-carbonyl]-1,3-thiazolidin-2-one.
| Compound Name | 3-[(1R,2R,3S,4S)-3-methylbicyclo[2.2.1]hept-5-ene-2-carbonyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 10922568 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 3-[(1R,2R,3S,4S)-3-methylbicyclo[2.2.1]hept-5-ene-2-carbonyl]-1,3-thiazolidin-2-one |
| SMILES | C[C@@H]1[C@@H](C(=O)N2CCSC2=O)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C12H15NO2S/c1-7-8-2-3-9(6-8)10(7)11(14)13-4-5-16-12(13)15/h2-3,7-10H,4-6H2,1H3/t7-,8+,9-,10+/m0/s1 |
| InChIKey | DXSLZPYLNISJFG-QCLAVDOMSA-N |
| XLogP | 2.14 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|