About (7-hydroxy-2,3-dihydro-1H-inden-1-yl)-methyl-prop-2-ynylazanium chloride
(7-hydroxy-2,3-dihydro-1H-inden-1-yl)-methyl-prop-2-ynylazanium chloride (PubChem CID 10922573) has the molecular formula C13H16ClNO
and a molecular weight of 237.73 g/mol. Its IUPAC name is (7-hydroxy-2,3-dihydro-1H-inden-1-yl)-methyl-prop-2-ynylazanium chloride.
Molecular Properties
| Compound Name | (7-hydroxy-2,3-dihydro-1H-inden-1-yl)-methyl-prop-2-ynylazanium chloride |
| PubChem CID | 10922573 |
| Molecular Formula | C13H16ClNO |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | (7-hydroxy-2,3-dihydro-1H-inden-1-yl)-methyl-prop-2-ynylazanium chloride |
| SMILES | C#CC[NH+](C)C1CCc2cccc(O)c21.[Cl-] |
| InChI | InChI=1S/C13H15NO.ClH/c1-3-9-14(2)11-8-7-10-5-4-6-12(15)13(10)11;/h1,4-6,11,15H,7-9H2,2H3;1H |
| InChIKey | LUQBYQSHZSZORA-UHFFFAOYSA-N |
| XLogP | -2.47 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (7-hydroxy-2,3-dihydro-1H-inden-1-yl)-methyl-prop-2-ynylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-hydroxy-2,3-dihydro-1H-inden-1-yl)-methyl-prop-2-ynylazanium chloride?
The IUPAC name of (7-hydroxy-2,3-dihydro-1H-inden-1-yl)-methyl-prop-2-ynylazanium chloride (CID 10922573) is (7-hydroxy-2,3-dihydro-1H-inden-1-yl)-methyl-prop-2-ynylazanium chloride.
What is the SMILES notation for (7-hydroxy-2,3-dihydro-1H-inden-1-yl)-methyl-prop-2-ynylazanium chloride?
The canonical SMILES for (7-hydroxy-2,3-dihydro-1H-inden-1-yl)-methyl-prop-2-ynylazanium chloride is C#CC[NH+](C)C1CCc2cccc(O)c21.[Cl-].
What is the InChIKey of (7-hydroxy-2,3-dihydro-1H-inden-1-yl)-methyl-prop-2-ynylazanium chloride?
The InChIKey is LUQBYQSHZSZORA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO.ClH/c1-3-9-14(2)11-8-7-10-5-4-6-12(15)13(10)11;/h1,4-6,11,15H,7-9H2,2H3;1H.
What are the key properties of (7-hydroxy-2,3-dihydro-1H-inden-1-yl)-methyl-prop-2-ynylazanium chloride?
(7-hydroxy-2,3-dihydro-1H-inden-1-yl)-methyl-prop-2-ynylazanium chloride has a molecular weight of 237.73 g/mol, XLogP of -2.47, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7-hydroxy-2,3-dihydro-1H-inden-1-yl)-methyl-prop-2-ynylazanium chloride is sourced from PubChem (CID 10922573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).