C14H22O3 — CID 10922602
(5R,6R)-6-but-3-enyl-2,2-dimethyl-1,3-dioxaspiro[4.5]decan-8-one (PubChem CID 10922602) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is (5R,6R)-6-but-3-enyl-2,2-dimethyl-1,3-dioxaspiro[4.5]decan-8-one.
| Compound Name | (5R,6R)-6-but-3-enyl-2,2-dimethyl-1,3-dioxaspiro[4.5]decan-8-one |
|---|---|
| PubChem CID | 10922602 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (5R,6R)-6-but-3-enyl-2,2-dimethyl-1,3-dioxaspiro[4.5]decan-8-one |
| SMILES | C=CCC[C@@H]1CC(=O)CC[C@]12COC(C)(C)O2 |
| InChI | InChI=1S/C14H22O3/c1-4-5-6-11-9-12(15)7-8-14(11)10-16-13(2,3)17-14/h4,11H,1,5-10H2,2-3H3/t11-,14+/m1/s1 |
| InChIKey | DAFBPKTVGDOYQL-RISCZKNCSA-N |
| XLogP | 2.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|