C17H17Cl2N3O — CID 109226240
5-(cyclopentylamino)-N-(3,5-dichlorophenyl)pyridine-3-carboxamide (PubChem CID 109226240) has the molecular formula C17H17Cl2N3O and a molecular weight of 350.25 g/mol. Its IUPAC name is 5-(cyclopentylamino)-N-(3,5-dichlorophenyl)pyridine-3-carboxamide.
| Compound Name | 5-(cyclopentylamino)-N-(3,5-dichlorophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109226240 |
| Molecular Formula | C17H17Cl2N3O |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 5-(cyclopentylamino)-N-(3,5-dichlorophenyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)c1cncc(NC2CCCC2)c1 |
| InChI | InChI=1S/C17H17Cl2N3O/c18-12-6-13(19)8-15(7-12)22-17(23)11-5-16(10-20-9-11)21-14-3-1-2-4-14/h5-10,14,21H,1-4H2,(H,22,23) |
| InChIKey | QCDMPHHVEIVFCS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |