C13H21NO3 — CID 10922635
tert-butyl 6-(oxiran-2-ylmethyl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 10922635) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is tert-butyl 6-(oxiran-2-ylmethyl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 6-(oxiran-2-ylmethyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 10922635 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | tert-butyl 6-(oxiran-2-ylmethyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC=CC1CC1CO1 |
| InChI | InChI=1S/C13H21NO3/c1-13(2,3)17-12(15)14-7-5-4-6-10(14)8-11-9-16-11/h4,6,10-11H,5,7-9H2,1-3H3 |
| InChIKey | UWTCVIGAOOTZEO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|