About (3E)-3-[3-(2-methyl-1,3-dioxolan-2-yl)propylidene]hexane-2,5-dione
(3E)-3-[3-(2-methyl-1,3-dioxolan-2-yl)propylidene]hexane-2,5-dione (PubChem CID 10922663) has the molecular formula C13H20O4
and a molecular weight of 240.30 g/mol. Its IUPAC name is (3E)-3-[3-(2-methyl-1,3-dioxolan-2-yl)propylidene]hexane-2,5-dione.
Molecular Properties
| Compound Name | (3E)-3-[3-(2-methyl-1,3-dioxolan-2-yl)propylidene]hexane-2,5-dione |
| PubChem CID | 10922663 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (3E)-3-[3-(2-methyl-1,3-dioxolan-2-yl)propylidene]hexane-2,5-dione |
| SMILES | CC(=O)C/C(=C\CCC1(C)OCCO1)C(C)=O |
| InChI | InChI=1S/C13H20O4/c1-10(14)9-12(11(2)15)5-4-6-13(3)16-7-8-17-13/h5H,4,6-9H2,1-3H3/b12-5+ |
| InChIKey | IFOADDWXGFPWSX-LFYBBSHMSA-N |
| XLogP | 2.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-[3-(2-methyl-1,3-dioxolan-2-yl)propylidene]hexane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-[3-(2-methyl-1,3-dioxolan-2-yl)propylidene]hexane-2,5-dione?
The IUPAC name of (3E)-3-[3-(2-methyl-1,3-dioxolan-2-yl)propylidene]hexane-2,5-dione (CID 10922663) is (3E)-3-[3-(2-methyl-1,3-dioxolan-2-yl)propylidene]hexane-2,5-dione.
What is the SMILES notation for (3E)-3-[3-(2-methyl-1,3-dioxolan-2-yl)propylidene]hexane-2,5-dione?
The canonical SMILES for (3E)-3-[3-(2-methyl-1,3-dioxolan-2-yl)propylidene]hexane-2,5-dione is CC(=O)C/C(=C\CCC1(C)OCCO1)C(C)=O.
What is the InChIKey of (3E)-3-[3-(2-methyl-1,3-dioxolan-2-yl)propylidene]hexane-2,5-dione?
The InChIKey is IFOADDWXGFPWSX-LFYBBSHMSA-N. The full InChI is InChI=1S/C13H20O4/c1-10(14)9-12(11(2)15)5-4-6-13(3)16-7-8-17-13/h5H,4,6-9H2,1-3H3/b12-5+.
What are the key properties of (3E)-3-[3-(2-methyl-1,3-dioxolan-2-yl)propylidene]hexane-2,5-dione?
(3E)-3-[3-(2-methyl-1,3-dioxolan-2-yl)propylidene]hexane-2,5-dione has a molecular weight of 240.30 g/mol, XLogP of 2.02, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-[3-(2-methyl-1,3-dioxolan-2-yl)propylidene]hexane-2,5-dione is sourced from PubChem (CID 10922663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).