C14H24O3 — CID 10922674
(3'aS,6'aR)-2'-methoxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene] (PubChem CID 10922674) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (3'aS,6'aR)-2'-methoxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene].
| Compound Name | (3'aS,6'aR)-2'-methoxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene] |
|---|---|
| PubChem CID | 10922674 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (3'aS,6'aR)-2'-methoxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene] |
| SMILES | COC1C[C@@H]2CC3(C[C@@H]2C1)OCC(C)(C)CO3 |
| InChI | InChI=1S/C14H24O3/c1-13(2)8-16-14(17-9-13)6-10-4-12(15-3)5-11(10)7-14/h10-12H,4-9H2,1-3H3/t10-,11+,12? |
| InChIKey | UFHHSISZELNSPJ-FOSCPWQOSA-N |
| XLogP | 2.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |