C14H24O3 — CID 10922676
(4S,5S)-2,2-dimethyl-5-[(Z)-oct-2-enyl]-1,3-dioxolane-4-carbaldehyde (PubChem CID 10922676) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (4S,5S)-2,2-dimethyl-5-[(Z)-oct-2-enyl]-1,3-dioxolane-4-carbaldehyde.
| Compound Name | (4S,5S)-2,2-dimethyl-5-[(Z)-oct-2-enyl]-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 10922676 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (4S,5S)-2,2-dimethyl-5-[(Z)-oct-2-enyl]-1,3-dioxolane-4-carbaldehyde |
| SMILES | CCCCC/C=C\C[C@@H]1OC(C)(C)O[C@@H]1C=O |
| InChI | InChI=1S/C14H24O3/c1-4-5-6-7-8-9-10-12-13(11-15)17-14(2,3)16-12/h8-9,11-13H,4-7,10H2,1-3H3/b9-8-/t12-,13+/m0/s1 |
| InChIKey | VHNCSLYDBDDQNX-GFUJYOBASA-N |
| XLogP | 3.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|