C17H22N4O4S — CID 109227677
N-(2-methoxyethyl)-5-[2-(4-sulfamoylphenyl)ethylamino]pyridine-3-carboxamide (PubChem CID 109227677) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is N-(2-methoxyethyl)-5-[2-(4-sulfamoylphenyl)ethylamino]pyridine-3-carboxamide.
| Compound Name | N-(2-methoxyethyl)-5-[2-(4-sulfamoylphenyl)ethylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109227677 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-(2-methoxyethyl)-5-[2-(4-sulfamoylphenyl)ethylamino]pyridine-3-carboxamide |
| SMILES | COCCNC(=O)c1cncc(NCCc2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C17H22N4O4S/c1-25-9-8-21-17(22)14-10-15(12-19-11-14)20-7-6-13-2-4-16(5-3-13)26(18,23)24/h2-5,10-12,20H,6-9H2,1H3,(H,21,22)(H2,18,23,24) |
| InChIKey | JLTSSYUYNZRCGF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|