C17H20ClN3O2 — CID 109227747
5-(2-chloro-4,6-dimethylanilino)-N-(2-methoxyethyl)pyridine-3-carboxamide (PubChem CID 109227747) has the molecular formula C17H20ClN3O2 and a molecular weight of 333.82 g/mol. Its IUPAC name is 5-(2-chloro-4,6-dimethylanilino)-N-(2-methoxyethyl)pyridine-3-carboxamide.
| Compound Name | 5-(2-chloro-4,6-dimethylanilino)-N-(2-methoxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109227747 |
| Molecular Formula | C17H20ClN3O2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 5-(2-chloro-4,6-dimethylanilino)-N-(2-methoxyethyl)pyridine-3-carboxamide |
| SMILES | COCCNC(=O)c1cncc(Nc2c(C)cc(C)cc2Cl)c1 |
| InChI | InChI=1S/C17H20ClN3O2/c1-11-6-12(2)16(15(18)7-11)21-14-8-13(9-19-10-14)17(22)20-4-5-23-3/h6-10,21H,4-5H2,1-3H3,(H,20,22) |
| InChIKey | FBZBJOKHWKPFJB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|