C15H30O2 — CID 10922846
(Z)-5,6,7,7-tetradeuterio-1,1-di(propan-2-yloxy)non-3-ene (PubChem CID 10922846) has the molecular formula C15H30O2 and a molecular weight of 246.43 g/mol. Its IUPAC name is (Z)-5,6,7,7-tetradeuterio-1,1-di(propan-2-yloxy)non-3-ene.
| Compound Name | (Z)-5,6,7,7-tetradeuterio-1,1-di(propan-2-yloxy)non-3-ene |
|---|---|
| PubChem CID | 10922846 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 246.43 g/mol |
| Exact Mass | 246.25 |
| IUPAC Name | (Z)-5,6,7,7-tetradeuterio-1,1-di(propan-2-yloxy)non-3-ene |
| SMILES | [2H]C(/C=C\CC(OC(C)C)OC(C)C)C([2H])C([2H])([2H])CC |
| InChI | InChI=1S/C15H30O2/c1-6-7-8-9-10-11-12-15(16-13(2)3)17-14(4)5/h10-11,13-15H,6-9,12H2,1-5H3/b11-10-/i7D2,8D,9D |
| InChIKey | ZPIYBVWXLBVMMZ-KRKWALOMSA-N |
| XLogP | 4.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|