C17H15ClF3N3O2 — CID 109228686
N-[2-chloro-5-(trifluoromethyl)phenyl]-5-morpholin-4-ylpyridine-3-carboxamide (PubChem CID 109228686) has the molecular formula C17H15ClF3N3O2 and a molecular weight of 385.77 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-5-morpholin-4-ylpyridine-3-carboxamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-5-morpholin-4-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 109228686 |
| Molecular Formula | C17H15ClF3N3O2 |
| Molecular Weight | 385.77 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-5-morpholin-4-ylpyridine-3-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1Cl)c1cncc(N2CCOCC2)c1 |
| InChI | InChI=1S/C17H15ClF3N3O2/c18-14-2-1-12(17(19,20)21)8-15(14)23-16(25)11-7-13(10-22-9-11)24-3-5-26-6-4-24/h1-2,7-10H,3-6H2,(H,23,25) |
| InChIKey | RFIXSSIBZOBGBG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.77 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |