C21H28N4O3 — CID 109229476
5-[2-(2-methoxyphenyl)ethylamino]-N-(2-morpholin-4-ylethyl)pyridine-3-carboxamide (PubChem CID 109229476) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is 5-[2-(2-methoxyphenyl)ethylamino]-N-(2-morpholin-4-ylethyl)pyridine-3-carboxamide.
| Compound Name | 5-[2-(2-methoxyphenyl)ethylamino]-N-(2-morpholin-4-ylethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109229476 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 5-[2-(2-methoxyphenyl)ethylamino]-N-(2-morpholin-4-ylethyl)pyridine-3-carboxamide |
| SMILES | COc1ccccc1CCNc1cncc(C(=O)NCCN2CCOCC2)c1 |
| InChI | InChI=1S/C21H28N4O3/c1-27-20-5-3-2-4-17(20)6-7-23-19-14-18(15-22-16-19)21(26)24-8-9-25-10-12-28-13-11-25/h2-5,14-16,23H,6-13H2,1H3,(H,24,26) |
| InChIKey | IAVZHUWBOODPFV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |