C14H15F2NO — CID 10922970
(2E)-2-(4,6-difluoro-2,3-dihydroinden-1-ylidene)-N-propan-2-ylacetamide (PubChem CID 10922970) has the molecular formula C14H15F2NO and a molecular weight of 251.28 g/mol. Its IUPAC name is (2E)-2-(4,6-difluoro-2,3-dihydroinden-1-ylidene)-N-propan-2-ylacetamide.
| Compound Name | (2E)-2-(4,6-difluoro-2,3-dihydroinden-1-ylidene)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 10922970 |
| Molecular Formula | C14H15F2NO |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | (2E)-2-(4,6-difluoro-2,3-dihydroinden-1-ylidene)-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)/C=C1\CCc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C14H15F2NO/c1-8(2)17-14(18)5-9-3-4-11-12(9)6-10(15)7-13(11)16/h5-8H,3-4H2,1-2H3,(H,17,18)/b9-5+ |
| InChIKey | NXJQHWRBWAXVLU-WEVVVXLNSA-N |
| XLogP | 2.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|