C22H33N5O — CID 109229882
5-[4-(diethylamino)-2-methylanilino]-N-[3-(dimethylamino)propyl]pyridine-3-carboxamide (PubChem CID 109229882) has the molecular formula C22H33N5O and a molecular weight of 383.54 g/mol. Its IUPAC name is 5-[4-(diethylamino)-2-methylanilino]-N-[3-(dimethylamino)propyl]pyridine-3-carboxamide.
| Compound Name | 5-[4-(diethylamino)-2-methylanilino]-N-[3-(dimethylamino)propyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109229882 |
| Molecular Formula | C22H33N5O |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.27 |
| IUPAC Name | 5-[4-(diethylamino)-2-methylanilino]-N-[3-(dimethylamino)propyl]pyridine-3-carboxamide |
| SMILES | CCN(CC)c1ccc(Nc2cncc(C(=O)NCCCN(C)C)c2)c(C)c1 |
| InChI | InChI=1S/C22H33N5O/c1-6-27(7-2)20-9-10-21(17(3)13-20)25-19-14-18(15-23-16-19)22(28)24-11-8-12-26(4)5/h9-10,13-16,25H,6-8,11-12H2,1-5H3,(H,24,28) |
| InChIKey | OJCOWMUCZQWWLZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|