C13H18O5 — CID 10923066
[(1R,3R,4R,7S,11S)-3-methoxy-2,10-dioxatricyclo[5.3.1.04,11]undec-8-en-8-yl]methyl acetate (PubChem CID 10923066) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is [(1R,3R,4R,7S,11S)-3-methoxy-2,10-dioxatricyclo[5.3.1.04,11]undec-8-en-8-yl]methyl acetate.
| Compound Name | [(1R,3R,4R,7S,11S)-3-methoxy-2,10-dioxatricyclo[5.3.1.04,11]undec-8-en-8-yl]methyl acetate |
|---|---|
| PubChem CID | 10923066 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | [(1R,3R,4R,7S,11S)-3-methoxy-2,10-dioxatricyclo[5.3.1.04,11]undec-8-en-8-yl]methyl acetate |
| SMILES | CO[C@@H]1O[C@H]2OC=C(COC(C)=O)[C@H]3CC[C@@H]1[C@@H]23 |
| InChI | InChI=1S/C13H18O5/c1-7(14)16-5-8-6-17-13-11-9(8)3-4-10(11)12(15-2)18-13/h6,9-13H,3-5H2,1-2H3/t9-,10-,11+,12-,13-/m1/s1 |
| InChIKey | GUZGPGIJHGLBNU-UJPOAAIJSA-N |
| XLogP | 1.43 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |