C20H22N4O4 — CID 109231125
methyl 2-[[5-(4-acetylpiperazine-1-carbonyl)-3-pyridinyl]amino]benzoate (PubChem CID 109231125) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is methyl 2-[[5-(4-acetylpiperazine-1-carbonyl)-3-pyridinyl]amino]benzoate.
| Compound Name | methyl 2-[[5-(4-acetylpiperazine-1-carbonyl)-3-pyridinyl]amino]benzoate |
|---|---|
| PubChem CID | 109231125 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | methyl 2-[[5-(4-acetylpiperazine-1-carbonyl)-3-pyridinyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1cncc(C(=O)N2CCN(C(C)=O)CC2)c1 |
| InChI | InChI=1S/C20H22N4O4/c1-14(25)23-7-9-24(10-8-23)19(26)15-11-16(13-21-12-15)22-18-6-4-3-5-17(18)20(27)28-2/h3-6,11-13,22H,7-10H2,1-2H3 |
| InChIKey | BEWZQUUTUBPXFC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |