C21H21FN4O2 — CID 109231488
[4-(4-fluorophenyl)piperazin-1-yl]-[5-(furan-2-ylmethylamino)-3-pyridinyl]methanone (PubChem CID 109231488) has the molecular formula C21H21FN4O2 and a molecular weight of 380.42 g/mol. Its IUPAC name is [4-(4-fluorophenyl)piperazin-1-yl]-[5-(furan-2-ylmethylamino)-3-pyridinyl]methanone.
| Compound Name | [4-(4-fluorophenyl)piperazin-1-yl]-[5-(furan-2-ylmethylamino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 109231488 |
| Molecular Formula | C21H21FN4O2 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | [4-(4-fluorophenyl)piperazin-1-yl]-[5-(furan-2-ylmethylamino)-3-pyridinyl]methanone |
| SMILES | O=C(c1cncc(NCc2ccco2)c1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H21FN4O2/c22-17-3-5-19(6-4-17)25-7-9-26(10-8-25)21(27)16-12-18(14-23-13-16)24-15-20-2-1-11-28-20/h1-6,11-14,24H,7-10,15H2 |
| InChIKey | OOGZAOROLQUKKC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |