C16H22N2O — CID 10923219
cis-(1S,2R)-2-ethenyl-1-[[(1S,2S,5S)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]amino]cyclopropane-1-carbonitrile (PubChem CID 10923219) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is cis-(1S,2R)-2-ethenyl-1-[[(1S,2S,5S)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]amino]cyclopropane-1-carbonitrile.
| Compound Name | cis-(1S,2R)-2-ethenyl-1-[[(1S,2S,5S)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]amino]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 10923219 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | cis-(1S,2R)-2-ethenyl-1-[[(1S,2S,5S)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]amino]cyclopropane-1-carbonitrile |
| SMILES | C=C[C@H]1C[C@]1(C#N)/N=C1\C[C@@H]2C[C@@H](C2(C)C)[C@]1(C)O |
| InChI | InChI=1S/C16H22N2O/c1-5-10-8-16(10,9-17)18-13-7-11-6-12(14(11,2)3)15(13,4)19/h5,10-12,19H,1,6-8H2,2-4H3/b18-13+/t10-,11-,12-,15-,16+/m0/s1 |
| InChIKey | WQEXKFBTBUJIJQ-UKBSSOHGSA-N |
| XLogP | 2.71 |
| TPSA | 56.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|