C22H22ClN3O2 — CID 109232606
5-(4-chloro-2-methoxy-5-methylanilino)-N-[(4-methylphenyl)methyl]pyridine-3-carboxamide (PubChem CID 109232606) has the molecular formula C22H22ClN3O2 and a molecular weight of 395.89 g/mol. Its IUPAC name is 5-(4-chloro-2-methoxy-5-methylanilino)-N-[(4-methylphenyl)methyl]pyridine-3-carboxamide.
| Compound Name | 5-(4-chloro-2-methoxy-5-methylanilino)-N-[(4-methylphenyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109232606 |
| Molecular Formula | C22H22ClN3O2 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 5-(4-chloro-2-methoxy-5-methylanilino)-N-[(4-methylphenyl)methyl]pyridine-3-carboxamide |
| SMILES | COc1cc(Cl)c(C)cc1Nc1cncc(C(=O)NCc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C22H22ClN3O2/c1-14-4-6-16(7-5-14)11-25-22(27)17-9-18(13-24-12-17)26-20-8-15(2)19(23)10-21(20)28-3/h4-10,12-13,26H,11H2,1-3H3,(H,25,27) |
| InChIKey | PRXIRZUOEFSOAF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |