C20H15F4N3O — CID 109233370
N-[(2-fluorophenyl)methyl]-5-[2-(trifluoromethyl)anilino]pyridine-3-carboxamide (PubChem CID 109233370) has the molecular formula C20H15F4N3O and a molecular weight of 389.35 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-5-[2-(trifluoromethyl)anilino]pyridine-3-carboxamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-5-[2-(trifluoromethyl)anilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109233370 |
| Molecular Formula | C20H15F4N3O |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-5-[2-(trifluoromethyl)anilino]pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1F)c1cncc(Nc2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C20H15F4N3O/c21-17-7-3-1-5-13(17)11-26-19(28)14-9-15(12-25-10-14)27-18-8-4-2-6-16(18)20(22,23)24/h1-10,12,27H,11H2,(H,26,28) |
| InChIKey | HTAAPJIZEMRXAS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |