C24H27N3O2 — CID 109234214
5-(2,6-diethylanilino)-N-[(2-methoxyphenyl)methyl]pyridine-3-carboxamide (PubChem CID 109234214) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 5-(2,6-diethylanilino)-N-[(2-methoxyphenyl)methyl]pyridine-3-carboxamide.
| Compound Name | 5-(2,6-diethylanilino)-N-[(2-methoxyphenyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109234214 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 5-(2,6-diethylanilino)-N-[(2-methoxyphenyl)methyl]pyridine-3-carboxamide |
| SMILES | CCc1cccc(CC)c1Nc1cncc(C(=O)NCc2ccccc2OC)c1 |
| InChI | InChI=1S/C24H27N3O2/c1-4-17-10-8-11-18(5-2)23(17)27-21-13-20(14-25-16-21)24(28)26-15-19-9-6-7-12-22(19)29-3/h6-14,16,27H,4-5,15H2,1-3H3,(H,26,28) |
| InChIKey | FSCSADUHKJEEIF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |