1,1,2,2-tetrafluoroethane-1,2-disulfonyl fluoride

C2F6O4S2 — CID 10923456

IUPAC1,1,2,2-tetrafluoroethane-1,2-disulfonyl fluoride
SMILESO=S(=O)(F)C(F)(F)C(F)(F)S(=O)(=O)F
InChIInChI=1S/C2F6O4S2/c3-1(4,13(7,9)10)2(5,6)14(8,11)12
InChIKeyPJMGRCOEKWYJPK-UHFFFAOYSA-N
MW266.14 g/mol
LogP0.77
Rot. Bonds3

About 1,1,2,2-tetrafluoroethane-1,2-disulfonyl fluoride

1,1,2,2-tetrafluoroethane-1,2-disulfonyl fluoride (PubChem CID 10923456) has the molecular formula C2F6O4S2 and a molecular weight of 266.14 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoroethane-1,2-disulfonyl fluoride.

Molecular Properties

Compound Name1,1,2,2-tetrafluoroethane-1,2-disulfonyl fluoride
PubChem CID10923456
Molecular FormulaC2F6O4S2
Molecular Weight266.14 g/mol
Exact Mass265.91
IUPAC Name1,1,2,2-tetrafluoroethane-1,2-disulfonyl fluoride
SMILESO=S(=O)(F)C(F)(F)C(F)(F)S(=O)(=O)F
InChIInChI=1S/C2F6O4S2/c3-1(4,13(7,9)10)2(5,6)14(8,11)12
InChIKeyPJMGRCOEKWYJPK-UHFFFAOYSA-N
XLogP0.77
TPSA68.28 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.14
LogP ≤ 50.77
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze 1,1,2,2-tetrafluoroethane-1,2-disulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,1,2,2-tetrafluoroethane-1,2-disulfonyl fluoride?
The IUPAC name of 1,1,2,2-tetrafluoroethane-1,2-disulfonyl fluoride (CID 10923456) is 1,1,2,2-tetrafluoroethane-1,2-disulfonyl fluoride.
What is the SMILES notation for 1,1,2,2-tetrafluoroethane-1,2-disulfonyl fluoride?
The canonical SMILES for 1,1,2,2-tetrafluoroethane-1,2-disulfonyl fluoride is O=S(=O)(F)C(F)(F)C(F)(F)S(=O)(=O)F.
What is the InChIKey of 1,1,2,2-tetrafluoroethane-1,2-disulfonyl fluoride?
The InChIKey is PJMGRCOEKWYJPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C2F6O4S2/c3-1(4,13(7,9)10)2(5,6)14(8,11)12.
What are the key properties of 1,1,2,2-tetrafluoroethane-1,2-disulfonyl fluoride?
1,1,2,2-tetrafluoroethane-1,2-disulfonyl fluoride has a molecular weight of 266.14 g/mol, XLogP of 0.77, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2,2-tetrafluoroethane-1,2-disulfonyl fluoride is sourced from PubChem (CID 10923456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).