C19H18N4O2 — CID 109234998
5-(4-methoxyanilino)-N-(pyridin-2-ylmethyl)pyridine-3-carboxamide (PubChem CID 109234998) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 5-(4-methoxyanilino)-N-(pyridin-2-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 5-(4-methoxyanilino)-N-(pyridin-2-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109234998 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 5-(4-methoxyanilino)-N-(pyridin-2-ylmethyl)pyridine-3-carboxamide |
| SMILES | COc1ccc(Nc2cncc(C(=O)NCc3ccccn3)c2)cc1 |
| InChI | InChI=1S/C19H18N4O2/c1-25-18-7-5-15(6-8-18)23-17-10-14(11-20-12-17)19(24)22-13-16-4-2-3-9-21-16/h2-12,23H,13H2,1H3,(H,22,24) |
| InChIKey | GYOMBJKMGIDTQH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |