C15H24O4 — CID 10923546
(1'R,4'aS,8'aR)-1'-(hydroxymethyl)-1',4'a-dimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-2'-one (PubChem CID 10923546) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (1'R,4'aS,8'aR)-1'-(hydroxymethyl)-1',4'a-dimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-2'-one.
| Compound Name | (1'R,4'aS,8'aR)-1'-(hydroxymethyl)-1',4'a-dimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-2'-one |
|---|---|
| PubChem CID | 10923546 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (1'R,4'aS,8'aR)-1'-(hydroxymethyl)-1',4'a-dimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-2'-one |
| SMILES | C[C@]12CCC(=O)[C@@](C)(CO)[C@@H]1CCCC21OCCO1 |
| InChI | InChI=1S/C15H24O4/c1-13(10-16)11-4-3-6-15(18-8-9-19-15)14(11,2)7-5-12(13)17/h11,16H,3-10H2,1-2H3/t11-,13-,14-/m0/s1 |
| InChIKey | LNUHNTQCZOBNGT-UBHSHLNASA-N |
| XLogP | 1.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |