C23H24FN3O2 — CID 109236233
N-[2-(2-fluorophenyl)ethyl]-5-[2-(4-methoxyphenyl)ethylamino]pyridine-3-carboxamide (PubChem CID 109236233) has the molecular formula C23H24FN3O2 and a molecular weight of 393.46 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-5-[2-(4-methoxyphenyl)ethylamino]pyridine-3-carboxamide.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-5-[2-(4-methoxyphenyl)ethylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109236233 |
| Molecular Formula | C23H24FN3O2 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-5-[2-(4-methoxyphenyl)ethylamino]pyridine-3-carboxamide |
| SMILES | COc1ccc(CCNc2cncc(C(=O)NCCc3ccccc3F)c2)cc1 |
| InChI | InChI=1S/C23H24FN3O2/c1-29-21-8-6-17(7-9-21)10-12-26-20-14-19(15-25-16-20)23(28)27-13-11-18-4-2-3-5-22(18)24/h2-9,14-16,26H,10-13H2,1H3,(H,27,28) |
| InChIKey | DPFUQCWEVDESGJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |