About [(3R)-3-amino-2,3-dihydro-1H-inden-5-yl] N-ethyl-N-methylcarbamate
[(3R)-3-amino-2,3-dihydro-1H-inden-5-yl] N-ethyl-N-methylcarbamate (PubChem CID 10923630) has the molecular formula C13H18N2O2
and a molecular weight of 234.30 g/mol. Its IUPAC name is [(3R)-3-amino-2,3-dihydro-1H-inden-5-yl] N-ethyl-N-methylcarbamate.
Molecular Properties
| Compound Name | [(3R)-3-amino-2,3-dihydro-1H-inden-5-yl] N-ethyl-N-methylcarbamate |
| PubChem CID | 10923630 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | [(3R)-3-amino-2,3-dihydro-1H-inden-5-yl] N-ethyl-N-methylcarbamate |
| SMILES | CCN(C)C(=O)Oc1ccc2c(c1)[C@H](N)CC2 |
| InChI | InChI=1S/C13H18N2O2/c1-3-15(2)13(16)17-10-6-4-9-5-7-12(14)11(9)8-10/h4,6,8,12H,3,5,7,14H2,1-2H3/t12-/m1/s1 |
| InChIKey | HTSFGBRWMBRBLU-GFCCVEGCSA-N |
| XLogP | 2.08 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3R)-3-amino-2,3-dihydro-1H-inden-5-yl] N-ethyl-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-3-amino-2,3-dihydro-1H-inden-5-yl] N-ethyl-N-methylcarbamate?
The IUPAC name of [(3R)-3-amino-2,3-dihydro-1H-inden-5-yl] N-ethyl-N-methylcarbamate (CID 10923630) is [(3R)-3-amino-2,3-dihydro-1H-inden-5-yl] N-ethyl-N-methylcarbamate.
What is the SMILES notation for [(3R)-3-amino-2,3-dihydro-1H-inden-5-yl] N-ethyl-N-methylcarbamate?
The canonical SMILES for [(3R)-3-amino-2,3-dihydro-1H-inden-5-yl] N-ethyl-N-methylcarbamate is CCN(C)C(=O)Oc1ccc2c(c1)[C@H](N)CC2.
What is the InChIKey of [(3R)-3-amino-2,3-dihydro-1H-inden-5-yl] N-ethyl-N-methylcarbamate?
The InChIKey is HTSFGBRWMBRBLU-GFCCVEGCSA-N. The full InChI is InChI=1S/C13H18N2O2/c1-3-15(2)13(16)17-10-6-4-9-5-7-12(14)11(9)8-10/h4,6,8,12H,3,5,7,14H2,1-2H3/t12-/m1/s1.
What are the key properties of [(3R)-3-amino-2,3-dihydro-1H-inden-5-yl] N-ethyl-N-methylcarbamate?
[(3R)-3-amino-2,3-dihydro-1H-inden-5-yl] N-ethyl-N-methylcarbamate has a molecular weight of 234.30 g/mol, XLogP of 2.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-3-amino-2,3-dihydro-1H-inden-5-yl] N-ethyl-N-methylcarbamate is sourced from PubChem (CID 10923630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).