C17H22O3 — CID 10923764
(1R,2S,6R,7S)-10-(5,5-dimethyl-1,3-dioxan-2-yl)tricyclo[5.2.2.02,6]undeca-4,10-dien-8-one (PubChem CID 10923764) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is (1R,2S,6R,7S)-10-(5,5-dimethyl-1,3-dioxan-2-yl)tricyclo[5.2.2.02,6]undeca-4,10-dien-8-one.
| Compound Name | (1R,2S,6R,7S)-10-(5,5-dimethyl-1,3-dioxan-2-yl)tricyclo[5.2.2.02,6]undeca-4,10-dien-8-one |
|---|---|
| PubChem CID | 10923764 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (1R,2S,6R,7S)-10-(5,5-dimethyl-1,3-dioxan-2-yl)tricyclo[5.2.2.02,6]undeca-4,10-dien-8-one |
| SMILES | CC1(C)COC(C2=C[C@H]3C(=O)C[C@@H]2[C@H]2CC=C[C@H]23)OC1 |
| InChI | InChI=1S/C17H22O3/c1-17(2)8-19-16(20-9-17)14-6-13-11-5-3-4-10(11)12(14)7-15(13)18/h3,5-6,10-13,16H,4,7-9H2,1-2H3/t10-,11+,12+,13+/m0/s1 |
| InChIKey | DGEXSDWJRYDXRM-UMSGYPCISA-N |
| XLogP | 2.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|