About 2-methyl-1,1-dioxo-1λ6,4,2-benzothiaselenazin-3-one
2-methyl-1,1-dioxo-1λ6,4,2-benzothiaselenazin-3-one (PubChem CID 10923818) has the molecular formula C8H7NO3SSe
and a molecular weight of 276.17 g/mol. Its IUPAC name is 2-methyl-1,1-dioxo-1λ6,4,2-benzothiaselenazin-3-one.
Molecular Properties
| Compound Name | 2-methyl-1,1-dioxo-1λ6,4,2-benzothiaselenazin-3-one |
| PubChem CID | 10923818 |
| Molecular Formula | C8H7NO3SSe |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 276.93 |
| IUPAC Name | 2-methyl-1,1-dioxo-1λ6,4,2-benzothiaselenazin-3-one |
| SMILES | CN1C(=O)[Se]c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C8H7NO3SSe/c1-9-8(10)14-7-5-3-2-4-6(7)13(9,11)12/h2-5H,1H3 |
| InChIKey | CXUGFFNZWAJPER-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1,1-dioxo-1λ6,4,2-benzothiaselenazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,1-dioxo-1λ6,4,2-benzothiaselenazin-3-one?
The IUPAC name of 2-methyl-1,1-dioxo-1λ6,4,2-benzothiaselenazin-3-one (CID 10923818) is 2-methyl-1,1-dioxo-1λ6,4,2-benzothiaselenazin-3-one.
What is the SMILES notation for 2-methyl-1,1-dioxo-1λ6,4,2-benzothiaselenazin-3-one?
The canonical SMILES for 2-methyl-1,1-dioxo-1λ6,4,2-benzothiaselenazin-3-one is CN1C(=O)[Se]c2ccccc2S1(=O)=O.
What is the InChIKey of 2-methyl-1,1-dioxo-1λ6,4,2-benzothiaselenazin-3-one?
The InChIKey is CXUGFFNZWAJPER-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3SSe/c1-9-8(10)14-7-5-3-2-4-6(7)13(9,11)12/h2-5H,1H3.
What are the key properties of 2-methyl-1,1-dioxo-1λ6,4,2-benzothiaselenazin-3-one?
2-methyl-1,1-dioxo-1λ6,4,2-benzothiaselenazin-3-one has a molecular weight of 276.17 g/mol, XLogP of -0.23, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,1-dioxo-1λ6,4,2-benzothiaselenazin-3-one is sourced from PubChem (CID 10923818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).