C23H25N3O — CID 109239101
N-(2,4-dimethylphenyl)-5-(3-phenylpropylamino)pyridine-3-carboxamide (PubChem CID 109239101) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-5-(3-phenylpropylamino)pyridine-3-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-5-(3-phenylpropylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109239101 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | N-(2,4-dimethylphenyl)-5-(3-phenylpropylamino)pyridine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cncc(NCCCc3ccccc3)c2)c(C)c1 |
| InChI | InChI=1S/C23H25N3O/c1-17-10-11-22(18(2)13-17)26-23(27)20-14-21(16-24-15-20)25-12-6-9-19-7-4-3-5-8-19/h3-5,7-8,10-11,13-16,25H,6,9,12H2,1-2H3,(H,26,27) |
| InChIKey | GFESFCIZZKDFLN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|