About 5-iodo-1,3,6-trimethylpyrimidine-2,4-dione
5-iodo-1,3,6-trimethylpyrimidine-2,4-dione (PubChem CID 10923939) has the molecular formula C7H9IN2O2
and a molecular weight of 280.06 g/mol. Its IUPAC name is 5-iodo-1,3,6-trimethylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-iodo-1,3,6-trimethylpyrimidine-2,4-dione |
| PubChem CID | 10923939 |
| Molecular Formula | C7H9IN2O2 |
| Molecular Weight | 280.06 g/mol |
| Exact Mass | 279.97 |
| IUPAC Name | 5-iodo-1,3,6-trimethylpyrimidine-2,4-dione |
| SMILES | Cc1c(I)c(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C7H9IN2O2/c1-4-5(8)6(11)10(3)7(12)9(4)2/h1-3H3 |
| InChIKey | OGGRCIQVWZBFPS-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.06 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-1,3,6-trimethylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-1,3,6-trimethylpyrimidine-2,4-dione?
The IUPAC name of 5-iodo-1,3,6-trimethylpyrimidine-2,4-dione (CID 10923939) is 5-iodo-1,3,6-trimethylpyrimidine-2,4-dione.
What is the SMILES notation for 5-iodo-1,3,6-trimethylpyrimidine-2,4-dione?
The canonical SMILES for 5-iodo-1,3,6-trimethylpyrimidine-2,4-dione is Cc1c(I)c(=O)n(C)c(=O)n1C.
What is the InChIKey of 5-iodo-1,3,6-trimethylpyrimidine-2,4-dione?
The InChIKey is OGGRCIQVWZBFPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9IN2O2/c1-4-5(8)6(11)10(3)7(12)9(4)2/h1-3H3.
What are the key properties of 5-iodo-1,3,6-trimethylpyrimidine-2,4-dione?
5-iodo-1,3,6-trimethylpyrimidine-2,4-dione has a molecular weight of 280.06 g/mol, XLogP of -0.00, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-1,3,6-trimethylpyrimidine-2,4-dione is sourced from PubChem (CID 10923939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).