C18H22ClN3O2 — CID 109239484
5-(tert-butylamino)-N-(4-chloro-2-methoxy-5-methylphenyl)pyridine-3-carboxamide (PubChem CID 109239484) has the molecular formula C18H22ClN3O2 and a molecular weight of 347.85 g/mol. Its IUPAC name is 5-(tert-butylamino)-N-(4-chloro-2-methoxy-5-methylphenyl)pyridine-3-carboxamide.
| Compound Name | 5-(tert-butylamino)-N-(4-chloro-2-methoxy-5-methylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109239484 |
| Molecular Formula | C18H22ClN3O2 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 5-(tert-butylamino)-N-(4-chloro-2-methoxy-5-methylphenyl)pyridine-3-carboxamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)c1cncc(NC(C)(C)C)c1 |
| InChI | InChI=1S/C18H22ClN3O2/c1-11-6-15(16(24-5)8-14(11)19)21-17(23)12-7-13(10-20-9-12)22-18(2,3)4/h6-10,22H,1-5H3,(H,21,23) |
| InChIKey | QHHLFIXHQFNAAZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |