C23H31N3O — CID 109239732
[5-[benzyl(propan-2-yl)amino]-3-pyridinyl]-(2-ethylpiperidin-1-yl)methanone (PubChem CID 109239732) has the molecular formula C23H31N3O and a molecular weight of 365.52 g/mol. Its IUPAC name is [5-[benzyl(propan-2-yl)amino]-3-pyridinyl]-(2-ethylpiperidin-1-yl)methanone.
| Compound Name | [5-[benzyl(propan-2-yl)amino]-3-pyridinyl]-(2-ethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 109239732 |
| Molecular Formula | C23H31N3O |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | [5-[benzyl(propan-2-yl)amino]-3-pyridinyl]-(2-ethylpiperidin-1-yl)methanone |
| SMILES | CCC1CCCCN1C(=O)c1cncc(N(Cc2ccccc2)C(C)C)c1 |
| InChI | InChI=1S/C23H31N3O/c1-4-21-12-8-9-13-25(21)23(27)20-14-22(16-24-15-20)26(18(2)3)17-19-10-6-5-7-11-19/h5-7,10-11,14-16,18,21H,4,8-9,12-13,17H2,1-3H3 |
| InChIKey | VKTURRICQOAFBM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |