C21H25N3O2 — CID 109240561
1-[3-[[5-(2-ethylpiperidine-1-carbonyl)-3-pyridinyl]amino]phenyl]ethanone (PubChem CID 109240561) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-[3-[[5-(2-ethylpiperidine-1-carbonyl)-3-pyridinyl]amino]phenyl]ethanone.
| Compound Name | 1-[3-[[5-(2-ethylpiperidine-1-carbonyl)-3-pyridinyl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 109240561 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 1-[3-[[5-(2-ethylpiperidine-1-carbonyl)-3-pyridinyl]amino]phenyl]ethanone |
| SMILES | CCC1CCCCN1C(=O)c1cncc(Nc2cccc(C(C)=O)c2)c1 |
| InChI | InChI=1S/C21H25N3O2/c1-3-20-9-4-5-10-24(20)21(26)17-12-19(14-22-13-17)23-18-8-6-7-16(11-18)15(2)25/h6-8,11-14,20,23H,3-5,9-10H2,1-2H3 |
| InChIKey | UPMQVMAHDTUXOJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |