C23H32N4O — CID 109240661
N-[4-(diethylamino)phenyl]-5-(2-ethylpiperidin-1-yl)pyridine-3-carboxamide (PubChem CID 109240661) has the molecular formula C23H32N4O and a molecular weight of 380.54 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-5-(2-ethylpiperidin-1-yl)pyridine-3-carboxamide.
| Compound Name | N-[4-(diethylamino)phenyl]-5-(2-ethylpiperidin-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109240661 |
| Molecular Formula | C23H32N4O |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-5-(2-ethylpiperidin-1-yl)pyridine-3-carboxamide |
| SMILES | CCC1CCCCN1c1cncc(C(=O)Nc2ccc(N(CC)CC)cc2)c1 |
| InChI | InChI=1S/C23H32N4O/c1-4-20-9-7-8-14-27(20)22-15-18(16-24-17-22)23(28)25-19-10-12-21(13-11-19)26(5-2)6-3/h10-13,15-17,20H,4-9,14H2,1-3H3,(H,25,28) |
| InChIKey | GIFSEEWVCIOVDG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|