C13H20O7 — CID 10924187
methyl 2-[(3aR,4S,6S,6aS)-6-formyl-4-methoxy-2,2,6-trimethyl-3a,6a-dihydrofuro[3,4-d][1,3]dioxol-4-yl]acetate (PubChem CID 10924187) has the molecular formula C13H20O7 and a molecular weight of 288.30 g/mol. Its IUPAC name is methyl 2-[(3aR,4S,6S,6aS)-6-formyl-4-methoxy-2,2,6-trimethyl-3a,6a-dihydrofuro[3,4-d][1,3]dioxol-4-yl]acetate.
| Compound Name | methyl 2-[(3aR,4S,6S,6aS)-6-formyl-4-methoxy-2,2,6-trimethyl-3a,6a-dihydrofuro[3,4-d][1,3]dioxol-4-yl]acetate |
|---|---|
| PubChem CID | 10924187 |
| Molecular Formula | C13H20O7 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | methyl 2-[(3aR,4S,6S,6aS)-6-formyl-4-methoxy-2,2,6-trimethyl-3a,6a-dihydrofuro[3,4-d][1,3]dioxol-4-yl]acetate |
| SMILES | COC(=O)C[C@]1(OC)O[C@](C)(C=O)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C13H20O7/c1-11(2)18-9-10(19-11)13(17-5,6-8(15)16-4)20-12(9,3)7-14/h7,9-10H,6H2,1-5H3/t9-,10+,12+,13-/m0/s1 |
| InChIKey | SFAXRXSOXQXETO-YGNMPJRFSA-N |
| XLogP | 0.40 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|